For research use only. Not for therapeutic Use.
4,7-Dibromo-2-(6-bromohexyl)-2H-benzo[d][1,2,3]triazole(Cat No.:L032240)is a high-purity heterocyclic compound used extensively in advanced chemical and pharmaceutical research. This molecule features a benzo[d][1,2,3]triazole core with dibromo substitutions at the 4 and 7 positions and a bromohexyl side chain. Its unique structure allows for selective reactivity, making it a valuable intermediate in the synthesis of complex organic molecules, including potential drug candidates and functional materials. 4,7-Dibromo-2-(6-bromohexyl)-2H-benzo[d][1,2,3]triazole is ideal for precise synthetic applications and innovative research.
CAS Number | 890704-02-6 |
Molecular Formula | C12H14Br3N3 |
Purity | ≥95% |
IUPAC Name | 4,7-dibromo-2-(6-bromohexyl)benzotriazole |
InChI | InChI=1S/C12H14Br3N3/c13-7-3-1-2-4-8-18-16-11-9(14)5-6-10(15)12(11)17-18/h5-6H,1-4,7-8H2 |
InChIKey | VWPRIVLLHDPAJM-UHFFFAOYSA-N |
SMILES | C1=C(C2=NN(N=C2C(=C1)Br)CCCCCCBr)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |