For research use only. Not for therapeutic Use.
4,7-Dibromo-2-phenylbenzo[d]thiazole(Cat No.:L032022)is a halogenated aromatic compound featuring two bromine atoms on a benzo[d]thiazole ring with a phenyl group at the 2-position. This compound is widely used in pharmaceutical research, organic synthesis, and materials science as a key intermediate in the development of complex molecules, including potential drug candidates and advanced materials. Its dual bromination provides unique reactivity, making it suitable for various chemical transformations, such as cross-coupling and halogen-exchange reactions. Researchers value this compound for creating innovative compounds in medicinal chemistry and material science.
CAS Number | 1588440-95-2 |
Molecular Formula | C13H7Br2NS |
Purity | ≥95% |
IUPAC Name | 4,7-dibromo-2-phenyl-1,3-benzothiazole |
InChI | InChI=1S/C13H7Br2NS/c14-9-6-7-10(15)12-11(9)16-13(17-12)8-4-2-1-3-5-8/h1-7H |
InChIKey | GRDUECATKOOADC-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=NC3=C(C=CC(=C3S2)Br)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |