For research use only. Not for therapeutic Use.
4,7-Phenanthroline is a bicyclic compound composed of three fused aromatic rings, known for its chelating properties with metal ions. This heterocyclic compound is widely used in analytical chemistry, particularly for the detection and quantification of metal ions in various solutions. It serves as a ligand in coordination chemistry, forming stable complexes with transition metals, which can enhance catalytic activity and selectivity. Additionally, 4,7-phenanthroline is explored for its potential biological activities, making it valuable in drug discovery and development.
| Catalog Number | M349095 |
| CAS Number | 230-07-9 |
| Molecular Formula | C12H8N2 |
| Purity | ≥95% |
| IUPAC Name | 4,7-phenanthroline |
| InChI | InChI=1S/C12H8N2/c1-3-9-10-4-2-8-14-12(10)6-5-11(9)13-7-1/h1-8H |
| InChIKey | DATYUTWESAKQQM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C=CC=N3)N=C1 |
