For research use only. Not for therapeutic Use.
4,8-Dibromoquinoline(CAT: L012064) is a high-purity brominated heterocyclic compound widely employed in pharmaceutical and chemical research. Its unique structure, featuring bromine substitutions on the quinoline core, makes it a versatile building block for the synthesis of bioactive molecules, advanced materials, and specialty chemicals. This compound is particularly valuable in medicinal chemistry for developing novel therapeutic agents and conducting structure-activity relationship studies. With excellent stability and reactivity, 4,8-Dibromoquinoline ensures precision and reliability, making it an essential tool for innovative drug discovery and advanced synthetic research applications.
CAS Number | 1070879-31-0 |
Molecular Formula | C9H5Br2N |
Purity | ≥95% |
IUPAC Name | 4,8-dibromoquinoline |
InChI | InChI=1S/C9H5Br2N/c10-7-4-5-12-9-6(7)2-1-3-8(9)11/h1-5H |
InChIKey | LNJMYWNYBSIPIS-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CN=C2C(=C1)Br)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |