For research use only. Not for therapeutic Use.
4,9-Dibromoisochromeno[6,5,4-def]isochromene-1,3,6,8-tetraone(CAT: L035120) is a high-purity polycyclic aromatic compound widely utilized in material science, pharmaceutical, and organic synthesis research. Featuring a dibrominated isochromeno-isochromene core with four ketone functionalities, this compound is a valuable intermediate for the development of advanced materials, including semiconductors and optoelectronic devices. Its unique structure also makes it useful in medicinal chemistry for the exploration of bioactive molecules. With exceptional stability and reactivity, 4,9-Dibromoisochromeno[6,5,4-def]isochromene-1,3,6,8-tetraone ensures precision and reliability, making it an essential tool for cutting-edge research and complex synthetic applications.
CAS Number | 83204-68-6 |
Molecular Formula | C14H2Br2O6 |
Purity | ≥95% |
IUPAC Name | 2,9-dibromo-6,13-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
InChI | InChI=1S/C14H2Br2O6/c15-5-1-3-7-8-4(12(18)22-13(19)9(5)8)2-6(16)10(7)14(20)21-11(3)17/h1-2H |
InChIKey | FEDCHNPLDKDTNS-UHFFFAOYSA-N |
SMILES | C1=C2C3=C4C(=CC(=C3C(=O)OC2=O)Br)C(=O)OC(=O)C4=C1Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |