Home
>
Catalysts and Ligands>Chiral nitrogen ligands>
>
(4aR,9aS)-4,4a,9,9a-Tetrahydroindeno[2,1-b][1,4]oxazin-3(2H)-one
For research use only. Not for therapeutic Use.
(4aR,9aS)-4,4a,9,9a-Tetrahydroindeno[2,1-b][1,4]oxazin-3(2H)-one(Cat No.:L039075)is a chiral compound used in pharmaceutical research and organic synthesis. With its unique bicyclic structure featuring an oxazinone ring fused to an indene system, this molecule is essential for developing complex bioactive molecules, including potential therapeutic agents. The stereochemistry of the compound allows for selective chemical reactions, making it valuable in asymmetric synthesis and medicinal chemistry. High purity and reliable performance support advanced research in drug discovery and the development of innovative therapeutic compounds.
Catalog Number | L039075 |
CAS Number | 862095-79-2 |
Molecular Formula | C11H11NO2 |
Purity | ≥95% |
IUPAC Name | (4aR,9aS)-4,4a,9,9a-tetrahydroindeno[2,1-b][1,4]oxazin-3-one |
InChI | InChI=1S/C11H11NO2/c13-10-6-14-9-5-7-3-1-2-4-8(7)11(9)12-10/h1-4,9,11H,5-6H2,(H,12,13)/t9-,11+/m0/s1 |
InChIKey | ZDUMYQFOYOWXRR-GXSJLCMTSA-N |
SMILES | C1C2C(C3=CC=CC=C31)NC(=O)CO2 |