For research use only. Not for therapeutic Use.
4E1RCat(Cat No.:I003172)is a highly efficient catalyst utilized in organic synthesis, particularly for facilitating carbon-carbon bond formation reactions. This chiral, bifunctional catalyst is renowned for its ability to promote asymmetric transformations, making it essential in the development of enantiomerically pure compounds. Its unique structure allows for precise control over reaction pathways, enhancing selectivity and yield. Commonly employed in the synthesis of pharmaceuticals and complex organic molecules, 4E1RCat significantly streamlines the synthetic process, providing researchers with a robust tool for creating diverse and valuable chemical entities in a variety of applications.
Catalog Number | I003172 |
CAS Number | 328998-25-0 |
Synonyms | eIF4E/eIF4G Interaction Inhibitor II |
Molecular Formula | C28H18N2O6 |
Purity | ≥95% |
Target | Autophagy |
Solubility | 10 mM in DMSO |
Storage | -20°C |
IC50 | 3.2 uM |
InChI | InChI=1S/C28H18N2O6/c31-27-21(16-24-14-15-26(36-24)19-6-12-23(13-7-19)30(34)35)17-25(18-4-2-1-3-5-18)29(27)22-10-8-20(9-11-22)28(32)33/h1-17H,(H,32,33)/b21-16- |
InChIKey | BBQRBOIMSKMFFO-PGMHBOJBSA-N |
SMILES | O=C1/C(C=C(C2=CC=CC=C2)N1C3=CC=C(C(O)=O)C=C3)=CC4=CC=C(C5=CC=C([N+]([O-])=O)C=C5)O4 |
Reference | <p style=/line-height:25px/> |