For research use only, not for therapeutic use.
4E2RCat（Cat No.:I013746）is a potent and selective inhibitor of IκB kinase (IKK) subunit β, essential for NF-κB signaling. By targeting this key enzyme, 4E2RCat blocks the phosphorylation and degradation of IκB proteins, thus preventing the activation of NF-κB. This pathway plays a crucial role in regulating immune responses, inflammation, and cell survival, making 4E2RCat a valuable tool in studying these processes. Its specificity toward IKKβ makes it useful for exploring inflammatory diseases, cancer, and other conditions where NF-κB dysregulation is implicated, offering potential therapeutic insights.
| Catalog Number | I013746 |
| CAS Number | 432499-63-3 |
| Molecular Formula | C₂₂H₁₄ClNO₄S₂ |
| Purity | ≥95% |
| Target | Eukaryotic Initiation Factor (eIF) |
| Solubility | DMSO: 15.5 mg/mL |
| IUPAC Name | 5-[5-[(Z)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoic acid |
| InChI | InChI=1S/C22H14ClNO4S2/c23-17-8-6-14(10-16(17)21(26)27)18-9-7-15(28-18)11-19-20(25)24(22(29)30-19)12-13-4-2-1-3-5-13/h1-11H,12H2,(H,26,27)/b19-11- |
| InChIKey | WOBPZFKXPCYOLU-ODLFYWEKSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C(=CC3=CC=C(O3)C4=CC(=C(C=C4)Cl)C(=O)O)SC2=S |
| Reference | [1]. Cencic R, et al. Blocking eIF4E-eIF4G interaction as a strategy to impair coronavirus replication. J Virol. 2011 Jul;85(13):6381-9. |
