For research use only. Not for therapeutic Use.
(4R)-2-Thioxo-4-thiazolidinecarboxylic Acid is a chiral intermediate used extensively in pharmaceutical and organic synthesis. Known for its role in the production of enantiomerically pure compounds, it is essential for developing new drugs and therapeutic agents. This compound’s high purity and stereochemical specificity ensure reliable and consistent results in experimental procedures. Its applications extend to medicinal chemistry and the development of active pharmaceutical ingredients, making it a valuable tool in advanced research and innovative drug design.
Catalog Number | R030890 |
CAS Number | 98169-56-3 |
Synonyms | (R)-2-Thioxo-4-thiazolidinecarboxylic Acid; (R)-(-)-Thiazolidine-2-thione-4-carboxylic Acid; (R)-(-)-Thiazolidine-2-thione-4-carboxylic Acid; (R)-Thiazolidine-2-thione-4-carboxylic Acid; Raphanusamic Acid |
Molecular Formula | C4H5NO2S2 |
Purity | ≥95% |
Storage | 3 years -20 ℃ |
IUPAC Name | (4R)-2-sulfanylidene-1,3-thiazolidine-4-carboxylic acid |
InChI | InChI=1S/C4H5NO2S2/c6-3(7)2-1-9-4(8)5-2/h2H,1H2,(H,5,8)(H,6,7)/t2-/m0/s1 |
InChIKey | SQUOCHQOQMZGQP-REOHCLBHSA-N |
SMILES | C1C(NC(=S)S1)C(=O)O |