For research use only. Not for therapeutic Use.
(4R)-4-Hydroxy-1-methylpyrrolidin-2-one(Cat No.:L007286), is a chemical compound known for its role in various research and pharmaceutical applications. It is a pyrrolidinone derivative containing a hydroxy group and a methyl group, with a stereocenter at the fourth position. Compounds with similar structures are often used in medicinal chemistry and drug design due to their biological activity and potential therapeutic applications. Researchers study these molecules to understand their interactions with biological targets, aiding in the development of new drugs and treatments. The specific stereochemistry of (4R)-4-Hydroxy-1-methylpyrrolidin-2-one makes it valuable in drug discovery processes, enabling scientists to design molecules with precise biological activities.
CAS Number | 252642-41-4 |
Molecular Formula | C5H9NO2 |
Purity | ≥95% |
IUPAC Name | (4R)-4-hydroxy-1-methylpyrrolidin-2-one |
InChI | InChI=1S/C5H9NO2/c1-6-3-4(7)2-5(6)8/h4,7H,2-3H2,1H3/t4-/m1/s1 |
InChIKey | YRVPVSMWSPGZSV-SCSAIBSYSA-N |
SMILES | CN1CC(CC1=O)O |