Home
>
Catalysts and Ligands>Chiral nitrogen ligands> (4R,4'R)-4,4'-Diisopropyl-4,4',5,5'-tetrahydro-2,2'-bioxazole
For research use only. Not for therapeutic Use.
(4R,4’R)-4,4′-Diisopropyl-4,4′,5,5′-tetrahydro-2,2′-bioxazole is a chiral bioxazole derivative with diisopropyl groups and tetrahydro functionality, making it valuable in stereoselective synthesis and asymmetric catalysis. Its rigid, chiral structure allows for enantioselective interactions, commonly applied in the development of pharmaceuticals and advanced organic molecules. This compound’s stability and chirality enable it to serve as a ligand or building block in creating complex chiral architectures, supporting precise control in synthetic chemistry and enhancing research in stereochemistry applications.
CAS Number | 148925-97-7 |
Molecular Formula | C12H20N2O2 |
Purity | ≥95% |
IUPAC Name | (4R)-4-propan-2-yl-2-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-4,5-dihydro-1,3-oxazole |
InChI | InChI=1S/C12H20N2O2/c1-7(2)9-5-15-11(13-9)12-14-10(6-16-12)8(3)4/h7-10H,5-6H2,1-4H3/t9-,10-/m0/s1 |
InChIKey | ZSZOYMBXNYZPFL-UWVGGRQHSA-N |
SMILES | CC(C)[C@@H]1COC(=N1)C2=N[C@@H](CO2)C(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |