Home
>
Catalysts and Ligands>Chiral nitrogen ligands> (4S,4'S)-2,2'-(2,3-Dihydro-1H-indene-2,2-diyl)bis(4-phenyl-4,5-dihydrooxazole)
For research use only. Not for therapeutic Use.
(4S,4’S)-2,2′-(2,3-Dihydro-1H-indene-2,2-diyl)bis(4-phenyl-4,5-dihydrooxazole) is a chiral molecule featuring a 2,3-dihydroindene core bridged by two oxazoline rings at the 4 and 4′ positions, each bearing a phenyl group. Its stereochemistry and rigid structure make it valuable in asymmetric synthesis as a chiral ligand or catalyst, often used to promote enantioselectivity in reactions. This compound’s combination of rigid and chiral elements enables precise control over molecular geometry, making it useful in pharmaceutical and materials science applications.
CAS Number | 188780-32-7 |
Molecular Formula | C27H24N2O2 |
Purity | ≥95% |
IUPAC Name | (4S)-4-phenyl-2-[2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-1,3-dihydroinden-2-yl]-4,5-dihydro-1,3-oxazole |
InChI | InChI=1S/C27H24N2O2/c1-3-9-19(10-4-1)23-17-30-25(28-23)27(15-21-13-7-8-14-22(21)16-27)26-29-24(18-31-26)20-11-5-2-6-12-20/h1-14,23-24H,15-18H2/t23-,24-/m1/s1 |
InChIKey | CXTGPFGXKVGOQY-DNQXCXABSA-N |
SMILES | C1[C@@H](N=C(O1)C2(CC3=CC=CC=C3C2)C4=N[C@H](CO4)C5=CC=CC=C5)C6=CC=CC=C6 |