For research use only. Not for therapeutic Use.
4SC-202 free base（Cat No.:I005425）is a selective inhibitor of the enzyme histone deacetylase (HDAC), which is involved in regulating gene expression through chromatin remodeling. This compound has shown potential in preclinical studies for its ability to induce apoptosis and inhibit proliferation in cancer cells, making it a candidate for cancer therapy. By modulating the acetylation status of histones and non-histone proteins, 4SC-202 may enhance the effectiveness of existing treatments and improve patient outcomes in various malignancies. Ongoing research focuses on its pharmacokinetics, safety, and therapeutic applications in oncology.
| Catalog Number | I005425 |
| CAS Number | 910462-43-0 |
| Synonyms | 4SC202 |
| Molecular Formula | C23H21N5O3S |
| Purity | ≥95% |
| Target | HDAC1/2/3 |
| Solubility | DMSO: ≥ 58 mg/mL |
| Storage | Store at -20℃ |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[1-[4-(1-methylpyrazol-4-yl)phenyl]sulfonylpyrrol-3-yl]prop-2-enamide |
| InChI | InChI=1S/C23H21N5O3S/c1-27-16-19(14-25-27)18-7-9-20(10-8-18)32(30,31)28-13-12-17(15-28)6-11-23(29)26-22-5-3-2-4-21(22)24/h2-16H,24H2,1H3,(H,26,29)/b11-6+ |
| InChIKey | PRXXYMVLYKJITB-IZZDOVSWSA-N |
| SMILES | CN1C=C(C=N1)C2=CC=C(C=C2)S(=O)(=O)N3C=CC(=C3)/C=C/C(=O)NC4=CC=CC=C4N |
| Reference | [1]. S.W.Henning, et al. Preclinical characterization of 4SC-202, a noval isotype specific HDAC inhibitor |
