For research use only. Not for therapeutic Use.
4SC-202（Cat No.:I000667）is a potent and selective inhibitor of the enzyme histone deacetylase 1 (HDAC1), known for its role in regulating gene expression through histone modification. This compound has shown promise in cancer therapy, particularly in hematologic malignancies, by promoting cell differentiation and apoptosis in tumor cells. By selectively inhibiting HDAC1, 4SC-202 enhances the acetylation of histones, leading to the reactivation of tumor suppressor genes. Ongoing clinical studies aim to evaluate its efficacy and safety, positioning 4SC-202 as a potential therapeutic candidate in the growing field of epigenetic cancer treatments.
| Catalog Number | I000667 |
| CAS Number | 1186222-89-8 |
| Molecular Formula | C₃₀H₂₉N₅O₆S₂ |
| Purity | ≥95% |
| Target | HDAC |
| Solubility | DMSO: ≥ 51 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[1-[4-(1-methylpyrazol-4-yl)phenyl]sulfonylpyrrol-3-yl]prop-2-enamide;4-methylbenzenesulfonic acid |
| InChI | InChI=1S/C23H21N5O3S.C7H8O3S/c1-27-16-19(14-25-27)18-7-9-20(10-8-18)32(30,31)28-13-12-17(15-28)6-11-23(29)26-22-5-3-2-4-21(22)24;1-6-2-4-7(5-3-6)11(8,9)10/h2-16H,24H2,1H3,(H,26,29);2-5H,1H3,(H,8,9,10)/b11-6+; |
| InChIKey | IAVXAZDVNICKFJ-ICSBZGNSSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CN1C=C(C=N1)C2=CC=C(C=C2)S(=O)(=O)N3C=CC(=C3)/C=C/C(=O)NC4=CC=CC=C4N |
| Reference | <p style=/line-height:25px/> |
