For research use only. Not for therapeutic Use.
5β-Dihydrocortisol(CAT: R021533) is a naturally occurring metabolite of cortisol, a steroid hormone produced by the adrenal glands. Its mode of action involves being an inactive and reduced form of cortisol, which can be further converted to active cortisol in the body. Pharmacologically, 5β-dihydrocortisol is not used as a therapeutic drug on its own. Instead, it serves as a biomarker in clinical and research settings to assess adrenal function and the metabolism of cortisol. Measurement of 5β-dihydrocortisol levels can provide valuable information about adrenal gland activity and the balance between cortisol production and metabolism.
CAS Number | 1482-50-4 |
Synonyms | (5β,11β)-11,17,21-Trihydroxypregnane-3,20-dione; 11β,17,21-Trihydroxy-5β-pregnane-3,20-dione; 11β,17α,21-Trihydroxy-5β-pregnane-3,20-dione; Dihydrocortisol; NSC 15473; |
Molecular Formula | C₂₁H₃₂O₅ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (5R,8S,9S,10S,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
InChI | 1S/C21H32O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h12,14-16,18,22,24,26H,3-11H2,1-2H3/t12-,14+,15+,16+,18-,19+,20+,21+/m1/s1 |
InChIKey | ACSFOIGNUQUIGE-AIPUTVCKSA-N |
SMILES | C[C@]12CCC(=O)C[C@H]1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@]4(C(=O)CO)O)C)O |