For research use only. Not for therapeutic Use.
5β-Pregnan-3α-ol-20-one is a steroid hormone derived from progesterone, notable for its role in the regulation of various physiological processes. This compound is involved in neurosteroid synthesis, influencing mood, behavior, and cognitive function. It exhibits potential neuroprotective and anxiolytic effects, making it of interest in research on anxiety and depression. Additionally, its presence in the central nervous system highlights its significance in neuroendocrine regulation. Researchers continue to study its mechanisms of action and potential therapeutic applications in mental health disorders.
CAS Number | 128-20-1 |
Synonyms | (3α,5β)-3-Hydroxy-pregnan-20-one; 3-Deoxo-3α-hydroxy-5β-dihydroprogesterone; 3α,5β-Pregnanolone; 3α,5β-Tetrahydroprogesterone; 3α-Hydroxy-20-oxo-5β-pregnane; 3α-Hydroxy-5β-tetrahydroprogesterone; NSC 82867; |
Molecular Formula | C21H34O2 |
Purity | ≥95% |
Target | GABA Receptor |
Solubility | Soluble in DMSO > 10 mM |
Storage | Store at RT |
IUPAC Name | 1-[(3R,5R,8R,9S,10S,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
InChI | 1S/C21H34O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19,23H,4-12H2,1-3H3/t14-,15-,16+,17-,18+,19+,20+,21-/m1/s1 |
InChIKey | AURFZBICLPNKBZ-YZRLXODZSA-N |
SMILES | CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |