For research use only. Not for therapeutic Use.
(5α,17α)-13-Ethyl-17-hydroxy-5-methoxy-18,19-dinorpregn-20-yn-3-one(Cat No.:M137847), It is a steroidal molecule featuring a 5-membered ring (cyclopentane) structure fused with various functional groups. Such structures are often involved in hormonal and pharmaceutical contexts due to their potential interactions with biological systems. This specific compound’s arrangement of atoms indicates its potential as a synthetic intermediate or precursor in hormone-related research or the synthesis of analogs for medical applications. Its complex structure implies diverse chemical reactivity and potential biological activity.
CAS Number | 155683-60-6 |
Molecular Formula | C22H32O3 |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | (5R,8R,9S,10R,13S,14S,17R)-13-ethyl-17-ethynyl-17-hydroxy-5-methoxy-2,4,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
InChI | InChI=1S/C22H32O3/c1-4-20-11-8-17-16(18(20)10-13-22(20,24)5-2)9-12-21(25-3)14-15(23)6-7-19(17)21/h2,16-19,24H,4,6-14H2,1,3H3/t16-,17+,18+,19-,20+,21-,22+/m1/s1 |
InChIKey | FOJSXAOBPRABPZ-WIJSBRJSSA-N |
SMILES | CCC12CCC3C(C1CCC2(C#C)O)CCC4(C3CCC(=O)C4)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |