For research use only. Not for therapeutic Use.
5-[1-(2,3-Dimethylphenyl)ethenyl]-1H-imidazole(Cat No.:R034453), It features an imidazole ring structure with a 1-(2,3-dimethylphenyl)ethenyl group attached. This compound’s structure suggests its potential applications in organic synthesis and as a building block for the creation of specialized molecules. The presence of the ethenyl group on the imidazole ring can impact its reactivity and properties, making it valuable for creating compounds with specific functions, potentially in pharmaceutical research or other chemical fields where unique structural motifs are desired.
CAS Number | 1021949-47-2 |
Molecular Formula | C13H14N2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 5-[1-(2,3-dimethylphenyl)ethenyl]-1H-imidazole |
InChI | InChI=1S/C13H14N2/c1-9-5-4-6-12(10(9)2)11(3)13-7-14-8-15-13/h4-8H,3H2,1-2H3,(H,14,15) |
InChIKey | YJOFSWIMUJKAGV-UHFFFAOYSA-N |
SMILES | CC1=CC=CC(=C1C)C(=C)C2=CN=CN2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |