Home
>
Reference Standards> 5-[2-Formyl-5-(hydroxymethyl)-1H-pyrrol-1-yl]-2-hydroxybenzoic Acid (>85percent by HPLC)
For research use only. Not for therapeutic Use.
5-[2-Formyl-5-(hydroxymethyl)-1H-pyrrol-1-yl]-2-hydroxybenzoic Acid is a high-purity compound used in organic synthesis and pharmaceutical research. This complex molecule is essential for studying its potential therapeutic properties, including anti-inflammatory and anticancer activities. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced chemical synthesis and drug development applications. Ideal for experimental setups, 5-[2-Formyl-5-(hydroxymethyl)-1H-pyrrol-1-yl]-2-hydroxybenzoic Acid enhances research accuracy and efficiency in various scientific investigations.
CAS Number | 876903-48-9 |
Molecular Formula | C13H11NO5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-[2-formyl-5-(hydroxymethyl)pyrrol-1-yl]-2-hydroxybenzoic acid |
InChI | InChI=1S/C13H11NO5/c15-6-9-1-2-10(7-16)14(9)8-3-4-12(17)11(5-8)13(18)19/h1-6,16-17H,7H2,(H,18,19) |
InChIKey | VUXRLABGWNUXQB-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1N2C(=CC=C2C=O)CO)C(=O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |