For research use only. Not for therapeutic Use.
5-(2-Iodophenyl)-1H-tetrazole(Cat No.:L006758). It consists of a tetrazole ring substituted with an iodophenyl group at the 5-position. This compound is utilized in medicinal chemistry and drug discovery research due to its unique structure and reactivity. Tetrazole derivatives often exhibit diverse biological activities, making them valuable in the development of pharmaceuticals. 5-(2-Iodophenyl)-1H-tetrazole can serve as a valuable building block for the synthesis of novel compounds, contributing to the creation of potential drug candidates.
Catalog Number | L006758 |
CAS Number | 73096-40-9 |
Molecular Formula | C7H5IN4 |
Purity | ≥95% |
IUPAC Name | 5-(2-iodophenyl)-2H-tetrazole |
InChI | InChI=1S/C7H5IN4/c8-6-4-2-1-3-5(6)7-9-11-12-10-7/h1-4H,(H,9,10,11,12) |
InChIKey | BISBCDUUTDMGBR-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C2=NNN=N2)I |