For research use only. Not for therapeutic Use.
5-(2-Methoxyethoxy)pyridine-3-carbaldehyde(Cat No.:L007723), is a chemical compound featuring a pyridine ring substituted with a formyl group and a methoxyethoxy moiety. This compound plays a significant role in organic synthesis and material science. Researchers utilize it as a valuable building block for creating various organic compounds, particularly in pharmaceutical research. Its applications include drug development, where it serves as a crucial intermediate for potential therapeutic agents.
CAS Number | 1596694-71-1 |
Molecular Formula | C9H11NO3 |
Purity | ≥95% |
IUPAC Name | 5-(2-methoxyethoxy)pyridine-3-carbaldehyde |
InChI | InChI=1S/C9H11NO3/c1-12-2-3-13-9-4-8(7-11)5-10-6-9/h4-7H,2-3H2,1H3 |
InChIKey | DAPNTTOJYNOKJU-UHFFFAOYSA-N |
SMILES | COCCOC1=CN=CC(=C1)C=O |