For research use only. Not for therapeutic Use.
5-(2-Pyridyl)-1,2-dihydropyridin-2-one is a heterocyclic compound used in advanced pharmaceutical and chemical research. Its unique structure, combining a pyridine and a dihydropyridinone ring, makes it a versatile intermediate in the synthesis of complex organic molecules. This compound is valuable in the development of biologically active substances, including potential therapeutic agents. Researchers leverage 5-(2-Pyridyl)-1,2-dihydropyridin-2-one for its role in drug discovery and its ability to facilitate reactions in medicinal chemistry.
Catalog Number | R021405 |
CAS Number | 381233-78-9 |
Synonyms | 5-(Pyridin-2-yl)-2(1H)-pyridone; |
Molecular Formula | C10H8N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-pyridin-2-yl-1H-pyridin-2-one |
InChI | InChI=1S/C10H8N2O/c13-10-5-4-8(7-12-10)9-3-1-2-6-11-9/h1-7H,(H,12,13) |
InChIKey | NHWKTZWOSIVHOL-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)C2=CNC(=O)C=C2 |