5-(3-Nitrophenyl)nicotinic acid(Cat No.:L031127)is an aromatic compound featuring a nitrophenyl group attached to the 5-position of a nicotinic acid core. This compound is widely used in pharmaceutical research and organic synthesis as a key intermediate in the development of bioactive molecules, including potential drug candidates. The presence of the nitro group enhances its reactivity, allowing for diverse chemical modifications and functionalizations. Its carboxylic acid functionality provides a handle for further derivatization, making it valuable in creating complex molecular structures for advanced research in medicinal chemistry and drug discovery.
Catalog Number | L031127 |
CAS Number | 898907-67-0 |
Molecular Formula | C12H8N2O4 |
Purity | ≥95% |
IUPAC Name | 5-(3-nitrophenyl)pyridine-3-carboxylic acid |
InChI | InChI=1S/C12H8N2O4/c15-12(16)10-4-9(6-13-7-10)8-2-1-3-11(5-8)14(17)18/h1-7H,(H,15,16) |
InChIKey | SCCBPJUNKJQITD-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CC(=CN=C2)C(=O)O |