For research use only. Not for therapeutic Use.
5-(3,5-Dicarboxybenzoyl)isophthalic acid (Cat.No:L003522) is a crucial compound in materials science. Its distinctive structure lends itself to the synthesis of specialized polymers and coordination complexes with diverse applications. This compound serves as a cornerstone in the development of advanced materials for electronics, optics, and catalysis.
CAS Number | 43080-50-8 |
Molecular Formula | C17H10O9 |
Purity | ≥95% |
IUPAC Name | 5-(3,5-dicarboxybenzoyl)benzene-1,3-dicarboxylic acid |
InChI | InChI=1S/C17H10O9/c18-13(7-1-9(14(19)20)5-10(2-7)15(21)22)8-3-11(16(23)24)6-12(4-8)17(25)26/h1-6H,(H,19,20)(H,21,22)(H,23,24)(H,25,26) |
InChIKey | NDEURWFVDGQGAG-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1C(=O)O)C(=O)O)C(=O)C2=CC(=CC(=C2)C(=O)O)C(=O)O |