Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
5-((3,5-Dichlorophenoxy)methyl)-1,2-dihydro-3H-pyrazol-3-one
For research use only. Not for therapeutic Use.
5-((3,5-Dichlorophenoxy)methyl)-1,2-dihydro-3H-pyrazol-3-one(CAT: L000444) is a compound of significance in the field of organic chemistry. This compound is valuable as a versatile intermediate for the synthesis of various organic molecules. Its unique structure, containing a dihydro-3H-pyrazol-3-one moiety, offers opportunities for diversifying chemical structures. Researchers and synthetic chemists often rely on its utility to create complex organic compounds for various applications, making it a valuable resource in the realm of organic chemistry and chemical synthesis.
Catalog Number | L000444 |
CAS Number | 1227692-67-2 |
Molecular Formula | C10H8Cl2N2O2 |
Purity | ≥95% |
IUPAC Name | 5-[(3,5-dichlorophenoxy)methyl]-1,2-dihydropyrazol-3-one |
InChI | InChI=1S/C10H8Cl2N2O2/c11-6-1-7(12)3-9(2-6)16-5-8-4-10(15)14-13-8/h1-4H,5H2,(H2,13,14,15) |
InChIKey | HTSQRRQNKJNSLH-UHFFFAOYSA-N |