For research use only. Not for therapeutic Use.
5-(4-Bromophenyl)isothiazole is an aromatic isothiazole derivative used in pharmaceutical and chemical research. Featuring a bromophenyl group attached to an isothiazole ring, this compound offers a unique framework ideal for synthesizing bioactive molecules, especially in drug discovery. The bromine substituent enhances reactivity, making it suitable for further modifications, such as cross-coupling reactions. Its structure supports the development of potential therapeutic agents and agrochemicals, aiding in the exploration of compounds with diverse biological activities and applications in medicinal chemistry.
CAS Number | 49602-97-3 |
Molecular Formula | C9H6BrNS |
Purity | ≥95% |
IUPAC Name | 5-(4-bromophenyl)-1,2-thiazole |
InChI | InChI=1S/C9H6BrNS/c10-8-3-1-7(2-4-8)9-5-6-11-12-9/h1-6H |
InChIKey | ULAQSIMEMVAAQI-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=CC=NS2)Br |