For research use only. Not for therapeutic Use.
5-(4-Bromophenyl)pyrrolidin-2-one(CAT: L036515) is an organic compound featuring a pyrrolidinone ring (a five-membered lactam) with a 4-bromophenyl group attached at the 5-position. The bromine atom on the phenyl ring introduces a site for further reactions, such as cross-coupling, which is useful in the synthesis of more complex molecules. The pyrrolidinone core is a common structure in medicinal chemistry, known for its presence in biologically active compounds. This compound can serve as an intermediate in the development of pharmaceuticals, particularly in the design of inhibitors, receptor modulators, or other bioactive molecules where the bromophenyl group and lactam ring play key roles in biological interactions.
Catalog Number | L036515 |
CAS Number | 207989-90-0 |
Molecular Formula | C10H10BrNO |
Purity | ≥95% |
IUPAC Name | 5-(4-bromophenyl)pyrrolidin-2-one |
InChI | InChI=1S/C10H10BrNO/c11-8-3-1-7(2-4-8)9-5-6-10(13)12-9/h1-4,9H,5-6H2,(H,12,13) |
InChIKey | PFJCJXIUAVSTJB-UHFFFAOYSA-N |