For research use only. Not for therapeutic Use.
5-(4-Ethylpiperazin-1-yl)pyridin-2-amine(Cat No.:L030413)is a specialized compound used in pharmaceutical research and organic synthesis. It features a piperazine ring linked to a pyridine core, making it an important intermediate in the development of various bioactive molecules, including potential therapeutic agents. The compound’s unique structure, with both amine and ethylpiperazine functionalities, allows for targeted modifications and chemical transformations. Its high purity and reliability make it valuable in medicinal chemistry, supporting the design and synthesis of innovative drugs and advanced research in therapeutic development.
CAS Number | 1018505-59-3 |
Molecular Formula | C11H18N4 |
Purity | ≥95% |
IUPAC Name | 5-(4-ethylpiperazin-1-yl)pyridin-2-amine |
InChI | InChI=1S/C11H18N4/c1-2-14-5-7-15(8-6-14)10-3-4-11(12)13-9-10/h3-4,9H,2,5-8H2,1H3,(H2,12,13) |
InChIKey | QKUYGFBCRZYCEB-UHFFFAOYSA-N |
SMILES | CCN1CCN(CC1)C2=CN=C(C=C2)N |