For research use only. Not for therapeutic Use.
5′-[4-(Hydroxymethyl)phenyl][1,1′:3′,1”-terphenyl]-4,4”-dimethanol (Cat.No:L003480) is a notable chemical compound with diverse applications in materials science. Its complex structure, incorporating phenyl and terphenyl moieties, lends itself to various electronic and optoelectronic applications. This compound is instrumental in the development of advanced materials for applications such as organic electronics, highlighting its significance in contemporary materials research.
CAS Number | 353289-47-1 |
Molecular Formula | C27H24O3 |
Purity | ≥95% |
IUPAC Name | [4-[3,5-bis[4-(hydroxymethyl)phenyl]phenyl]phenyl]methanol |
InChI | InChI=1S/C27H24O3/c28-16-19-1-7-22(8-2-19)25-13-26(23-9-3-20(17-29)4-10-23)15-27(14-25)24-11-5-21(18-30)6-12-24/h1-15,28-30H,16-18H2 |
InChIKey | KIMHSAOJBYOCOQ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CO)C2=CC(=CC(=C2)C3=CC=C(C=C3)CO)C4=CC=C(C=C4)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |