Home
>
Chemical Reagents>Heterocyclic Building Blocks> 5-(5-Hydroxybenzo[b]thiophen-2-yl)-1H-pyrrole-2-carboxylic acid
For research use only. Not for therapeutic Use.
5-(5-Hydroxybenzo[b]thiophen-2-yl)-1H-pyrrole-2-carboxylic acid is a complex heterocyclic compound featuring a pyrrole ring attached to a benzo[b]thiophene moiety with a hydroxyl group. This structure imparts unique chemical properties, enhancing its potential applications in medicinal chemistry and organic synthesis. The carboxylic acid functionality allows for various chemical transformations, while the hydroxyl group can participate in hydrogen bonding and improve solubility. This compound may serve as a valuable scaffold for developing pharmaceuticals and exploring structure-activity relationships in drug discovery.
CAS Number | 1897826-70-8 |
Molecular Formula | C13H9NO3S |
Purity | ≥95% |
IUPAC Name | 5-(5-hydroxy-1-benzothiophen-2-yl)-1H-pyrrole-2-carboxylic acid |
InChI | InChI=1S/C13H9NO3S/c15-8-1-4-11-7(5-8)6-12(18-11)9-2-3-10(14-9)13(16)17/h1-6,14-15H,(H,16,17) |
InChIKey | FUOGIAIWMVMESN-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1O)C=C(S2)C3=CC=C(N3)C(=O)O |