For research use only. Not for therapeutic Use.
5-Acetoxymethyl-2-furaldehyde is a high-purity compound essential for advanced pharmaceutical and chemical research. This furan derivative is crucial for studies involving organic synthesis, flavor and fragrance development, and chemical intermediates. Known for its stability and reactivity, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
Catalog Number | R020450 |
CAS Number | 10551-58-3 |
Synonyms | 5-[(Acetyloxy)methyl]-2-furancarboxaldehyde; 5-Acetoxymethylfurfural; (5-Formylfuran-2-yl)methyl Acetate; 5-(Acetoxymethyl)-2-furancarboxaldehyde; 5-Formyl-2-furfuryl Acetate; 5-Formyl-2-furylmethyl Acetate; 5-Formylfurfuryl Acetate; |
Molecular Formula | C8H8O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (5-formylfuran-2-yl)methyl acetate |
InChI | InChI=1S/C8H8O4/c1-6(10)11-5-8-3-2-7(4-9)12-8/h2-4H,5H2,1H3 |
InChIKey | QAVITTVTXPZTSE-UHFFFAOYSA-N |
SMILES | CC(=O)OCC1=CC=C(O1)C=O |