For research use only. Not for therapeutic Use.
5-Acetyl-2-norbornene is a cyclic compound used in organic synthesis as a building block for various molecules. Its unique structure, featuring a norbornene ring with an acetyl group at the 5th position, allows for diverse chemical transformations. This compound serves as a versatile intermediate in the preparation of pharmaceuticals, agrochemicals, and materials, contributing to advancements in synthetic chemistry and drug discovery.
CAS Number | 5063-03-6 |
Synonyms | Ketone Methyl 5-norbornen-2-yl; 1-(Bicyclo[2.2.1]hept-5-en-2-yl)ethanone; 2-Acetyl-5-norbornene; 2-Acetylbicyclo[2.2.1]hept-5-ene; 5-Acetylnorbornene; 6-Acetylbicyclo[2.2.1]hept-2-ene; Methyl 5-norbornen-2-yl ketone |
Molecular Formula | C9H12O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(5-bicyclo[2.2.1]hept-2-enyl)ethanone |
InChI | InChI=1S/C9H12O/c1-6(10)9-5-7-2-3-8(9)4-7/h2-3,7-9H,4-5H2,1H3 |
InChIKey | NIMLCWCLVJRPFY-UHFFFAOYSA-N |
SMILES | CC(=O)C1CC2CC1C=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |