For research use only. Not for therapeutic Use.
5-Acetylamino-6-amino-3-methyluracil Hydrate is a modified uracil derivative with significant potential in pharmaceutical research. This compound features both acetylamino and amino functional groups, enhancing its biological activity. It is primarily studied for its applications in nucleoside analogs and as a potential therapeutic agent in antiviral and anticancer therapies. The hydrate form increases its solubility and bioavailability, making it an attractive candidate for drug development. Ongoing research aims to elucidate its mechanisms of action and optimize its therapeutic efficacy.
| Catalog Number | R001135 |
| CAS Number | 1196153-01-1 |
| Synonyms | AAMU |
| Molecular Formula | C₇H₁₂N₄O₄ |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | 1S/C7H10N4O3.H2O/c1-3(12)9-4-5(8)10-7(14)11(2)6(4)13;/h8H2,1-2H3,(H,9,12)(H,10,14);1H2 |
| InChIKey | UISWGTUSVPTGHL-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(NC(=O)N(C1=O)C)N.O |
