5-Amino-1-(propan-2-yl)piperidin-2-one(Cat No.:L007417), is a chemical compound. It belongs to the class of piperidin-2-one derivatives, which are important intermediates in organic synthesis and medicinal chemistry. This compound likely finds applications in pharmaceutical research and development due to the presence of both an amino group and a piperidine-2-one moiety. These functional groups are common in many bioactive compounds, making this molecule valuable in the design and synthesis of potential drugs.
Catalog Number | L007417 |
CAS Number | 1334148-30-9 |
Molecular Formula | C8H16N2O |
Purity | ≥95% |
IUPAC Name | 5-amino-1-propan-2-ylpiperidin-2-one |
InChI | InChI=1S/C8H16N2O/c1-6(2)10-5-7(9)3-4-8(10)11/h6-7H,3-5,9H2,1-2H3 |
InChIKey | PYYGTGLZDNQCHV-UHFFFAOYSA-N |
SMILES | CC(C)N1CC(CCC1=O)N |