For research use only. Not for therapeutic Use.
5-Amino-1,3-dihydroxymethylbenzene(Cat No.:M014770) is an organic compound characterized by its benzene ring substituted with amino and hydroxymethyl groups. This structure incorporates both amino (-NH2) and hydroxymethyl (-CH2OH) functional groups at positions 5 and 1,3 respectively on the benzene ring. These groups confer polarity and reactivity to the molecule, making it a versatile intermediate in chemical synthesis. It is particularly useful in the production of dyes, pharmaceuticals, and other advanced organic compounds. The presence of multiple functional groups allows for various chemical reactions, enhancing its applicability in creating complex molecular architectures in synthetic chemistry.
CAS Number | 71176-54-0 |
Synonyms | 5-AMINO-1,3-DIHYDROXYMETHYLBENZENE;(3-AMino-5-hydroxyMethyl-phenyl)-Methanol;(5-Amino-1,3-phenylene)dimethanol;5-amino-1,3-Benzenedimethanol;3,5-Di(hydroxymethyl)aniline |
Molecular Formula | C8H11NO2 |
Purity | ≥95% |
Storage | -20°C |
Related CAS | 942063-57-2 |
IUPAC Name | [3-amino-5-(hydroxymethyl)phenyl]methanol |
InChI | InChI=1S/C8H11NO2/c9-8-2-6(4-10)1-7(3-8)5-11/h1-3,10-11H,4-5,9H2 |
InChIKey | YZRLJOVKGWVBHP-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1CO)N)CO |