For research use only. Not for therapeutic Use.
5-Amino-15N-Levulinic Acid HCl is an isotopically labeled version of 5-aminolevulinic acid, where the nitrogen atom is replaced with nitrogen-15. This compound is particularly valuable in biochemical and medical research, especially in studies involving the heme biosynthesis pathway, where 5-aminolevulinic acid is a key intermediate. The incorporation of nitrogen-15 allows for precise tracking in mass spectrometry and NMR spectroscopy, providing enhanced accuracy in studying metabolic pathways, enzyme kinetics, and the synthesis of porphyrins. 5-Amino-15N-Levulinic Acid HCl is essential for research in areas such as photodynamic therapy, cancer research, and the development of diagnostic tools, offering reliable and detailed data for scientific investigations.
CAS Number | 116571-80-3 |
Synonyms | 5-AMINO-15N-LEVULINIC ACID HCL |
Molecular Formula | C5H10ClNO3 |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | 5-(15N)azanyl-4-oxopentanoic acid;hydrochloride |
InChI | InChI=1S/C5H9NO3.ClH/c6-3-4(7)1-2-5(8)9;/h1-3,6H2,(H,8,9);1H/i6+1; |
InChIKey | ZLHFONARZHCSET-NWZHYJCUSA-N |
SMILES | C(CC(=O)O)C(=O)C[15NH2].Cl |