For research use only. Not for therapeutic Use.
5-Amino-(1H)-1,2,4-triazole-3-acetic acid is a triazole derivative featuring an amino group and an acetic acid moiety. This compound is of interest in medicinal and organic chemistry due to the triazole ring, which is known for its biological activity and ability to interact with enzymes and receptors. Its structure makes it valuable for the synthesis of bioactive molecules and pharmaceutical agents, particularly in the development of antifungal, antimicrobial, and anticancer compounds, as triazole derivatives are widely studied for therapeutic applications.
CAS Number | 143832-52-4 |
Synonyms | 5-Amino-3-carboxymethyl-1,2,4-triazole; 5-Amino-1H-1,2,4-triazole-3-acetic Acid |
Molecular Formula | C4H6N4O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(3-amino-1H-1,2,4-triazol-5-yl)acetic acid |
InChI | InChI=1S/C4H6N4O2/c5-4-6-2(7-8-4)1-3(9)10/h1H2,(H,9,10)(H3,5,6,7,8) |
InChIKey | ONMNOXQLJYNSKN-UHFFFAOYSA-N |
SMILES | C(C1=NC(=NN1)N)C(=O)O |