For research use only. Not for therapeutic Use.
5-Amino-2-chloro-4-fluorobenzonitrile (Cat.No:L003763) is a crucial chemical compound with versatile applications in pharmaceutical research. Its unique combination of amino, chloro, and fluoro substituents imparts distinct reactivity and biological activity. This compound serves as a valuable scaffold in the synthesis of novel pharmaceuticals, highlighting its significance in drug discovery.
Catalog Number | L003763 |
CAS Number | 123614-87-9 |
Molecular Formula | C7H4ClFN2 |
Purity | ≥95% |
IUPAC Name | 5-amino-2-chloro-4-fluorobenzonitrile |
InChI | InChI=1S/C7H4ClFN2/c8-5-2-6(9)7(11)1-4(5)3-10/h1-2H,11H2 |
InChIKey | AQGLHOVZNMAWIW-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1N)F)Cl)C#N |