For research use only. Not for therapeutic Use.
(5-Amino-2-(hydroxymethyl)phenyl)boronic acid (CAT: L000231) is a pivotal compound in pharmaceutical and organic chemistry. Its versatile structure allows it to serve as a crucial building block for the synthesis of various organic molecules, including pharmaceutical agents. In pharmaceutical research, it plays a significant role by facilitating the introduction of boronic acid functionality into drug candidates, influencing their biological activity, and targeting specific processes.
CAS Number | 914397-76-5 |
Molecular Formula | C7H10BNO3 |
Purity | ≥95% |
IUPAC Name | [5-amino-2-(hydroxymethyl)phenyl]boronic acid |
InChI | InChI=1S/C7H10BNO3/c9-6-2-1-5(4-10)7(3-6)8(11)12/h1-3,10-12H,4,9H2 |
InChIKey | OSUCVBVWCGEPNU-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |