For research use only. Not for therapeutic Use.
5-Amino-2-methoxy-4-picoline(Cat No.:L024075)is a heterocyclic compound commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. This compound features an amino group at the 5-position, a methoxy group at the 2-position, and a methyl group on the pyridine ring, which provide it with unique reactivity and versatility in chemical synthesis. It is particularly valuable in the development of bioactive molecules, including enzyme inhibitors and other therapeutic agents. Its structure allows for various chemical modifications, making it a key building block in medicinal chemistry and drug discovery.
CAS Number | 6635-91-2 |
Molecular Formula | C7H10N2O |
Purity | ≥95% |
IUPAC Name | 6-methoxy-4-methylpyridin-3-amine |
InChI | InChI=1S/C7H10N2O/c1-5-3-7(10-2)9-4-6(5)8/h3-4H,8H2,1-2H3 |
InChIKey | PADDNCJJHROILV-UHFFFAOYSA-N |
SMILES | CC1=CC(=NC=C1N)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |