Home
>
Chemical Reagents>Heterocyclic Building Blocks> 5-amino-2,3-dihydro-1H-isoindole-2-carbaldehyde
For research use only. Not for therapeutic Use.
5-Amino-2,3-dihydro-1H-isoindole-2-carbaldehyde(Cat No.:L007205), is a chemical compound. It features an isoindole core—a bicyclic structure—substituted with an amino group at the 5th position and an aldehyde group at the 2nd position. This compound is significant in organic synthesis and medicinal chemistry research. Its unique structure and functional groups make it valuable for creating diverse organic molecules, often used as a building block for various heterocyclic compounds. Researchers utilize 5-Amino-2,3-dihydro-1H-isoindole-2-carbaldehyde in the development of pharmaceuticals, agrochemicals, and materials, contributing to advancements in drug discovery and chemical innovation.
CAS Number | 1009-25-2 |
Molecular Formula | C9H10N2O |
Purity | ≥95% |
IUPAC Name | 5-amino-1,3-dihydroisoindole-2-carbaldehyde |
InChI | InChI=1S/C9H10N2O/c10-9-2-1-7-4-11(6-12)5-8(7)3-9/h1-3,6H,4-5,10H2 |
InChIKey | FJRIJCZUSRTPQD-UHFFFAOYSA-N |
SMILES | C1C2=C(CN1C=O)C=C(C=C2)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |