For research use only. Not for therapeutic Use.
5-Amino-6-methylnicotinonitrile(Cat No.:L031840)is a specialized organic compound featuring a nicotinic acid derivative structure modified with amino and nitrile groups. This molecular arrangement enhances its reactivity, making it a valuable precursor in the synthesis of various pharmaceuticals, particularly those targeting neurological and cardiovascular diseases. The amino group facilitates further chemical modifications through reactions such as acylation and alkylation, while the nitrile group can be converted into carboxylic acids or amides, expanding its utility in medicinal chemistry. This compound’s ability to form multiple bonds and rings makes it crucial for developing new drugs with improved efficacy and safety profiles.
CAS Number | 3308-01-8 |
Molecular Formula | C7H7N3 |
Purity | ≥95% |
IUPAC Name | 5-amino-6-methylpyridine-3-carbonitrile |
InChI | InChI=1S/C7H7N3/c1-5-7(9)2-6(3-8)4-10-5/h2,4H,9H2,1H3 |
InChIKey | MWTRDJRVPIKZGV-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=N1)C#N)N |