Home
>
Chemical Reagents>Heterocyclic Building Blocks> 5-Amino-7-chloro-2-(2-furyl)[1,2,4]triazolo[1,5-c]pyrimidine
For research use only. Not for therapeutic Use.
5-Amino-7-chloro-2-(2-furyl)[1,2,4]triazolo[1,5-c]pyrimidine is a heterocyclic compound featuring a triazolopyrimidine framework with an amino group (-NH₂) at the fifth position, a chlorine atom at the seventh position, and a furyl group attached at the second position. Its chemical formula is C₉H₈ClN₅O. This compound is of interest in medicinal chemistry due to its potential biological activities, including antitumor and antimicrobial properties. The diverse functional groups enhance its reactivity and make it a valuable scaffold for drug development.
CAS Number | 213896-64-1 |
Molecular Formula | C9H6ClN5O |
Purity | ≥95% |
IUPAC Name | 7-chloro-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
InChI | InChI=1S/C9H6ClN5O/c10-6-4-7-13-8(5-2-1-3-16-5)14-15(7)9(11)12-6/h1-4H,(H2,11,12) |
InChIKey | ALFSSSOPSVBKPW-UHFFFAOYSA-N |
SMILES | C1=COC(=C1)C2=NN3C(=N2)C=C(N=C3N)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |