For research use only. Not for therapeutic Use.
5-Aminoindole(CAT: R001423) is a high-purity heterocyclic compound featuring an amino group attached to the indole core, making it a critical building block in pharmaceutical research and organic synthesis. Its unique structure is valuable for developing bioactive molecules, small-molecule inhibitors, and therapeutic candidates, particularly in medicinal chemistry and drug discovery. Known for its versatility and reactivity, 5-Aminoindole enables the synthesis of complex heterocycles, dyes, and advanced intermediates. This compound supports innovative pathways in both academic and industrial research, offering reliability and precision for applications in fine chemical development and pharmaceutical innovation.
CAS Number | 5192-03-0 |
Synonyms | (Indol-5-yl)amine; 5-Indolamine; NSC 61452 |
Molecular Formula | C8H8N2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1H-indol-5-amine |
InChI | InChI=1S/C8H8N2/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5,10H,9H2 |
InChIKey | ZCBIFHNDZBSCEP-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CN2)C=C1N |