For research use only. Not for therapeutic Use.
5-Aminoisophthalic acid is an aromatic compound featuring an amino group and two carboxylic acid groups attached to a benzene ring. It is widely used as a building block in organic synthesis, particularly in the production of polymers, dyes, and pharmaceuticals. Its functional groups provide versatile reactivity for creating complex molecules, making it valuable in research and industrial applications. Additionally, 5-aminoisophthalic acid is explored in materials science for the development of metal-organic frameworks (MOFs) and other advanced materials.
CAS Number | 99-31-0 |
Molecular Formula | C8H7NO4 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 5-aminobenzene-1,3-dicarboxylic acid |
InChI | InChI=1S/C8H7NO4/c9-6-2-4(7(10)11)1-5(3-6)8(12)13/h1-3H,9H2,(H,10,11)(H,12,13) |
InChIKey | KBZFDRWPMZESDI-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1C(=O)O)N)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |