For research use only. Not for therapeutic Use.
5-(Aminomethyl)-2-fluorophenol hydrochloride (Cat.No:L003482) is a significant chemical compound with applications in pharmaceutical research. Its unique structure and functional groups make it a valuable intermediate in the synthesis of specialized pharmaceutical agents. This compound’s presence of both an amino and a fluorine group offers opportunities for the development of bioactive molecules.
CAS Number | 2044704-82-5 |
Molecular Formula | C7H9ClFNO |
Purity | ≥95% |
IUPAC Name | 5-(aminomethyl)-2-fluorophenol;hydrochloride |
InChI | InChI=1S/C7H8FNO.ClH/c8-6-2-1-5(4-9)3-7(6)10;/h1-3,10H,4,9H2;1H |
InChIKey | CBLGDPLYSQHYOU-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1CN)O)F.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |