Home
>
Chemical Reagents>Heterocyclic Building Blocks> 5-Aminomethyl-pyridine-2-carboxylic acid methyl ester dihydrochloride
For research use only. Not for therapeutic Use.
5-Aminomethyl-pyridine-2-carboxylic acid methyl ester dihydrochloride(Cat No.:L013498)is a specialized compound used in pharmaceutical research and organic synthesis. Featuring an aminomethyl group on a pyridine ring and a methyl ester functional group, this compound is crucial for the development of bioactive molecules, including potential therapeutic agents. The dihydrochloride salt form enhances its solubility and stability, making it suitable for various chemical reactions. With its unique structure, it allows for selective modifications, supporting advanced research in medicinal chemistry and the synthesis of innovative drugs and fine chemicals.
Catalog Number | L013498 |
CAS Number | 1375471-89-8 |
Molecular Formula | C8H12Cl2N2O2 |
Purity | ≥95% |
IUPAC Name | methyl 5-(aminomethyl)pyridine-2-carboxylate;dihydrochloride |
InChI | InChI=1S/C8H10N2O2.2ClH/c1-12-8(11)7-3-2-6(4-9)5-10-7;;/h2-3,5H,4,9H2,1H3;2*1H |
InChIKey | HMQDPWOEGJKCQX-UHFFFAOYSA-N |
SMILES | COC(=O)C1=NC=C(C=C1)CN.Cl.Cl |