For research use only. Not for therapeutic Use.
5-(Aminomethyl)nicotinamide dihydrochloride(Cat No.:L011785)is a highly specialized compound used in pharmaceutical and biochemical research. This nicotinamide derivative, with an aminomethyl group at the 5-position, plays a critical role in the synthesis of complex molecules and in studying biological processes related to nicotinamide pathways. The dihydrochloride form enhances its stability and solubility, making it suitable for various experimental applications. It is particularly valuable in medicinal chemistry and drug development, where it supports the exploration of new therapeutic agents and the investigation of metabolic and enzymatic mechanisms.
CAS Number | 1956365-61-9 |
Molecular Formula | C7H11Cl2N3O |
Purity | ≥95% |
IUPAC Name | 5-(aminomethyl)pyridine-3-carboxamide;dihydrochloride |
InChI | InChI=1S/C7H9N3O.2ClH/c8-2-5-1-6(7(9)11)4-10-3-5;;/h1,3-4H,2,8H2,(H2,9,11);2*1H |
InChIKey | BESJMEPTAZZBFL-UHFFFAOYSA-N |
SMILES | C1=C(C=NC=C1C(=O)N)CN.Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |