For research use only. Not for therapeutic Use.
5-Aminopropylindole(Cat No.:R059788)is a versatile chemical compound widely used in organic synthesis and medicinal chemistry. This indole derivative, featuring an aminopropyl side chain, serves as a key building block for creating various biologically active molecules, including pharmaceuticals and research chemicals. Its unique structure enables the formation of stable conjugates with other functional groups, facilitating the development of novel compounds with potential therapeutic applications. Due to its reactivity and adaptability, 5-Aminopropylindole is a valuable tool for researchers exploring new chemical pathways and drug discovery processes.
CAS Number | 3784-30-3 |
Synonyms | 5-(2-Aminopropyl)indole; α-Methyl-1H-indole-5-ethanamine; 5-IT; |
Molecular Formula | C11H14N2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(1H-indol-5-yl)propan-2-amine |
InChI | InChI=1S/C11H14N2/c1-8(12)6-9-2-3-11-10(7-9)4-5-13-11/h2-5,7-8,13H,6,12H2,1H3 |
InChIKey | AULGMISRJWGTBA-UHFFFAOYSA-N |
SMILES | CC(CC1=CC2=C(C=C1)NC=C2)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |