For research use only. Not for therapeutic Use.
5-(Aminosulfonyl)-2-methoxy-benzoic Acid Methyl Ester (CAT: R041804) is a chemical compound with relevance in both pharmaceutical and organic chemistry. This compound serves as a valuable intermediate in the synthesis of pharmaceutical agents and bioactive molecules. Its versatile structure allows for modifications and derivatizations, making it a useful building block for drug discovery and development. In pharmaceutical research, it plays a crucial role in the creation of novel drug candidates and the synthesis of pharmacologically active compounds.
CAS Number | 33045-52-2 |
Synonyms | 4-Methoxy-3-(methoxycarbonyl)benzenesulfonamide; Methyl 2-Methoxy-5-sulfamoylbenzoate; Methyl 5-(Aminosulfonyl)-2-methoxybenzoate; Methyl 5-Sulfamoyl-2-methoxybenzoate |
Molecular Formula | C9H11NO5S |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | methyl 2-methoxy-5-sulfamoylbenzoate |
InChI | InChI=1S/C9H11NO5S/c1-14-8-4-3-6(16(10,12)13)5-7(8)9(11)15-2/h3-5H,1-2H3,(H2,10,12,13) |
InChIKey | MKDYDRQLKPGNNU-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1)S(=O)(=O)N)C(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |